C16H24N3O2+ — CID 7471195
N'-(4-ethylphenyl)-N-(piperidin-1-ium-4-ylmethyl)oxamide (PubChem CID 7471195) has the molecular formula C16H24N3O2+ and a molecular weight of 290.39 g/mol. Its IUPAC name is N'-(4-ethylphenyl)-N-(piperidin-1-ium-4-ylmethyl)oxamide.
| Compound Name | N'-(4-ethylphenyl)-N-(piperidin-1-ium-4-ylmethyl)oxamide |
|---|---|
| PubChem CID | 7471195 |
| Molecular Formula | C16H24N3O2+ |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | N'-(4-ethylphenyl)-N-(piperidin-1-ium-4-ylmethyl)oxamide |
| SMILES | CCc1ccc(NC(=O)C(=O)NCC2CC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C16H23N3O2/c1-2-12-3-5-14(6-4-12)19-16(21)15(20)18-11-13-7-9-17-10-8-13/h3-6,13,17H,2,7-11H2,1H3,(H,18,20)(H,19,21)/p+1 |
| InChIKey | YHFJGAYWHWKJIP-UHFFFAOYSA-O |
| XLogP | 0.28 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|