C18H13O6PS2-2 — CID 22897883
3-[phenyl-(3-sulfinatooxyphenyl)phosphanyl]benzenesulfonate (PubChem CID 22897883) has the molecular formula C18H13O6PS2-2 and a molecular weight of 420.40 g/mol. Its IUPAC name is 3-[phenyl-(3-sulfinatooxyphenyl)phosphanyl]benzenesulfonate.
| Compound Name | 3-[phenyl-(3-sulfinatooxyphenyl)phosphanyl]benzenesulfonate |
|---|---|
| PubChem CID | 22897883 |
| Molecular Formula | C18H13O6PS2-2 |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 3-[phenyl-(3-sulfinatooxyphenyl)phosphanyl]benzenesulfonate |
| SMILES | O=S([O-])Oc1cccc(P(c2ccccc2)c2cccc(S(=O)(=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H15O6PS2/c19-26(20)24-14-6-4-9-16(12-14)25(15-7-2-1-3-8-15)17-10-5-11-18(13-17)27(21,22)23/h1-13H,(H,19,20)(H,21,22,23)/p-2 |
| InChIKey | XTZAUGLBDATQDD-UHFFFAOYSA-L |
| XLogP | 1.52 |
| TPSA | 106.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|