C31H32O4 — CID 22900338
1-methoxy-4-[1,1,3-tris(4-methoxyphenyl)propyl]benzene (PubChem CID 22900338) has the molecular formula C31H32O4 and a molecular weight of 468.59 g/mol. Its IUPAC name is 1-methoxy-4-[1,1,3-tris(4-methoxyphenyl)propyl]benzene.
| Compound Name | 1-methoxy-4-[1,1,3-tris(4-methoxyphenyl)propyl]benzene |
|---|---|
| PubChem CID | 22900338 |
| Molecular Formula | C31H32O4 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 1-methoxy-4-[1,1,3-tris(4-methoxyphenyl)propyl]benzene |
| SMILES | COc1ccc(CCC(c2ccc(OC)cc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H32O4/c1-32-27-13-5-23(6-14-27)21-22-31(24-7-15-28(33-2)16-8-24,25-9-17-29(34-3)18-10-25)26-11-19-30(35-4)20-12-26/h5-20H,21-22H2,1-4H3 |
| InChIKey | LAMSRQVIQRJILG-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|