C12H17N5O2S — CID 22900831
N-[4-(2-formylhydrazinyl)phenyl]-3-(methylcarbamothioylamino)propanamide (PubChem CID 22900831) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is N-[4-(2-formylhydrazinyl)phenyl]-3-(methylcarbamothioylamino)propanamide.
| Compound Name | N-[4-(2-formylhydrazinyl)phenyl]-3-(methylcarbamothioylamino)propanamide |
|---|---|
| PubChem CID | 22900831 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-[4-(2-formylhydrazinyl)phenyl]-3-(methylcarbamothioylamino)propanamide |
| SMILES | CNC(=S)NCCC(=O)Nc1ccc(NNC=O)cc1 |
| InChI | InChI=1S/C12H17N5O2S/c1-13-12(20)14-7-6-11(19)16-9-2-4-10(5-3-9)17-15-8-18/h2-5,8,17H,6-7H2,1H3,(H,15,18)(H,16,19)(H2,13,14,20) |
| InChIKey | AQVBLAQXWRDNIO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|