C17H19N7O3 — CID 59946818
N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-[4-(2-formylhydrazinyl)phenyl]butanediamide (PubChem CID 59946818) has the molecular formula C17H19N7O3 and a molecular weight of 369.39 g/mol. Its IUPAC name is N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-[4-(2-formylhydrazinyl)phenyl]butanediamide.
| Compound Name | N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-[4-(2-formylhydrazinyl)phenyl]butanediamide |
|---|---|
| PubChem CID | 59946818 |
| Molecular Formula | C17H19N7O3 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N'-(2,3-dihydro-1H-benzotriazol-5-yl)-N-[4-(2-formylhydrazinyl)phenyl]butanediamide |
| SMILES | O=CNNc1ccc(NC(=O)CCC(=O)Nc2ccc3c(c2)NNN3)cc1 |
| InChI | InChI=1S/C17H19N7O3/c25-10-18-21-12-3-1-11(2-4-12)19-16(26)7-8-17(27)20-13-5-6-14-15(9-13)23-24-22-14/h1-6,9-10,21-24H,7-8H2,(H,18,25)(H,19,26)(H,20,27) |
| InChIKey | LAUOQACIXOSDCN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 135.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|