C17H18N8O2S — CID 20661676
3-[4-(2-formylhydrazinyl)anilino]-N-[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]propanamide (PubChem CID 20661676) has the molecular formula C17H18N8O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is 3-[4-(2-formylhydrazinyl)anilino]-N-[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]propanamide.
| Compound Name | 3-[4-(2-formylhydrazinyl)anilino]-N-[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 20661676 |
| Molecular Formula | C17H18N8O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3-[4-(2-formylhydrazinyl)anilino]-N-[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]propanamide |
| SMILES | O=CNNc1ccc(NCCC(=O)Nc2cccc(-n3[nH]nnc3=S)c2)cc1 |
| InChI | InChI=1S/C17H18N8O2S/c26-11-19-21-13-6-4-12(5-7-13)18-9-8-16(27)20-14-2-1-3-15(10-14)25-17(28)22-23-24-25/h1-7,10-11,18,21H,8-9H2,(H,19,26)(H,20,27)(H,22,24,28) |
| InChIKey | QGGXWTDABSRPKQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|