C21H26N6O3S — CID 161247333
N,N-diethylethanamine;2-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoyl]benzoic acid (PubChem CID 161247333) has the molecular formula C21H26N6O3S and a molecular weight of 442.55 g/mol. Its IUPAC name is N,N-diethylethanamine;2-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoyl]benzoic acid.
| Compound Name | N,N-diethylethanamine;2-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 161247333 |
| Molecular Formula | C21H26N6O3S |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N,N-diethylethanamine;2-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]carbamoyl]benzoic acid |
| SMILES | CCN(CC)CC.O=C(O)c1ccccc1C(=O)Nc1cccc(-n2[nH]nnc2=S)c1 |
| InChI | InChI=1S/C15H11N5O3S.C6H15N/c21-13(11-6-1-2-7-12(11)14(22)23)16-9-4-3-5-10(8-9)20-15(24)17-18-19-20;1-4-7(5-2)6-3/h1-8H,(H,16,21)(H,22,23)(H,17,19,24);4-6H2,1-3H3 |
| InChIKey | VAURKTLQXCXTON-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|