C11H13N5OS2 — CID 59814910
N-(2-methylsulfanylethyl)-3-(5-sulfanylidene-2H-tetrazol-1-yl)benzamide (PubChem CID 59814910) has the molecular formula C11H13N5OS2 and a molecular weight of 295.39 g/mol. Its IUPAC name is N-(2-methylsulfanylethyl)-3-(5-sulfanylidene-2H-tetrazol-1-yl)benzamide.
| Compound Name | N-(2-methylsulfanylethyl)-3-(5-sulfanylidene-2H-tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 59814910 |
| Molecular Formula | C11H13N5OS2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | N-(2-methylsulfanylethyl)-3-(5-sulfanylidene-2H-tetrazol-1-yl)benzamide |
| SMILES | CSCCNC(=O)c1cccc(-n2[nH]nnc2=S)c1 |
| InChI | InChI=1S/C11H13N5OS2/c1-19-6-5-12-10(17)8-3-2-4-9(7-8)16-11(18)13-14-15-16/h2-4,7H,5-6H2,1H3,(H,12,17)(H,13,15,18) |
| InChIKey | FJQPKBHZSKFOCN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|