C11H11N5O2S2 — CID 54488391
2-methyl-3-sulfanylidene-3-[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]propanoic acid (PubChem CID 54488391) has the molecular formula C11H11N5O2S2 and a molecular weight of 309.38 g/mol. Its IUPAC name is 2-methyl-3-sulfanylidene-3-[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]propanoic acid.
| Compound Name | 2-methyl-3-sulfanylidene-3-[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]propanoic acid |
|---|---|
| PubChem CID | 54488391 |
| Molecular Formula | C11H11N5O2S2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-methyl-3-sulfanylidene-3-[3-(5-sulfanylidene-2H-tetrazol-1-yl)anilino]propanoic acid |
| SMILES | CC(C(=O)O)C(=S)Nc1cccc(-n2[nH]nnc2=S)c1 |
| InChI | InChI=1S/C11H11N5O2S2/c1-6(10(17)18)9(19)12-7-3-2-4-8(5-7)16-11(20)13-14-15-16/h2-6H,1H3,(H,12,19)(H,17,18)(H,13,15,20) |
| InChIKey | XTZNRFSXABYPQY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|