C20H23F3N6O — CID 22901328
1-[8-propan-2-yl-6-[4-(trifluoromethyl)anilino]-7H-purin-2-yl]piperidin-4-ol (PubChem CID 22901328) has the molecular formula C20H23F3N6O and a molecular weight of 420.44 g/mol. Its IUPAC name is 1-[8-propan-2-yl-6-[4-(trifluoromethyl)anilino]-7H-purin-2-yl]piperidin-4-ol.
| Compound Name | 1-[8-propan-2-yl-6-[4-(trifluoromethyl)anilino]-7H-purin-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 22901328 |
| Molecular Formula | C20H23F3N6O |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1-[8-propan-2-yl-6-[4-(trifluoromethyl)anilino]-7H-purin-2-yl]piperidin-4-ol |
| SMILES | CC(C)c1nc2nc(N3CCC(O)CC3)nc(Nc3ccc(C(F)(F)F)cc3)c2[nH]1 |
| InChI | InChI=1S/C20H23F3N6O/c1-11(2)16-25-15-17(24-13-5-3-12(4-6-13)20(21,22)23)27-19(28-18(15)26-16)29-9-7-14(30)8-10-29/h3-6,11,14,30H,7-10H2,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | QTUCOLTUVVJUAE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |