C13H23N3O4S — CID 22901439
N-butyl-N-methyl-1-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]oxadiazolo[4,3-a]azepin-5-yl)methanesulfonamide (PubChem CID 22901439) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-butyl-N-methyl-1-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]oxadiazolo[4,3-a]azepin-5-yl)methanesulfonamide.
| Compound Name | N-butyl-N-methyl-1-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]oxadiazolo[4,3-a]azepin-5-yl)methanesulfonamide |
|---|---|
| PubChem CID | 22901439 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-butyl-N-methyl-1-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]oxadiazolo[4,3-a]azepin-5-yl)methanesulfonamide |
| SMILES | CCCCN(C)S(=O)(=O)CC1CCCCc2noc(=O)n21 |
| InChI | InChI=1S/C13H23N3O4S/c1-3-4-9-15(2)21(18,19)10-11-7-5-6-8-12-14-20-13(17)16(11)12/h11H,3-10H2,1-2H3 |
| InChIKey | UYWHBGVEWWPLBK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 85.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |