About 3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate
3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate (PubChem CID 22902220) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is 3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate.
Analyze 3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate?
The IUPAC name of 3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate (CID 22902220) is 3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate.
What is the SMILES notation for 3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate?
The canonical SMILES for 3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate is CCOC(=O)C12C=CC=CC1CN(C(=O)OC)C2.
What is the InChIKey of 3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate?
The InChIKey is NAYQRLNNSKVKTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-3-18-11(15)13-7-5-4-6-10(13)8-14(9-13)12(16)17-2/h4-7,10H,3,8-9H2,1-2H3.
What are the key properties of 3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate?
3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate has a molecular weight of 251.28 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3a-O-ethyl 2-O-methyl 3,7a-dihydro-1H-isoindole-2,3a-dicarboxylate is sourced from PubChem (CID 22902220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).