C13H22N4O3 — CID 22903730
N-(2-amino-2-oxoethyl)-4-(2-oxopiperidin-1-yl)piperidine-4-carboxamide (PubChem CID 22903730) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-(2-oxopiperidin-1-yl)piperidine-4-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-(2-oxopiperidin-1-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22903730 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-(2-oxopiperidin-1-yl)piperidine-4-carboxamide |
| SMILES | NC(=O)CNC(=O)C1(N2CCCCC2=O)CCNCC1 |
| InChI | InChI=1S/C13H22N4O3/c14-10(18)9-16-12(20)13(4-6-15-7-5-13)17-8-2-1-3-11(17)19/h15H,1-9H2,(H2,14,18)(H,16,20) |
| InChIKey | JRTUJDGKNBRESF-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |