C28H34F3N5O6 — CID 22904936
3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22904936) has the molecular formula C28H34F3N5O6 and a molecular weight of 593.60 g/mol. Its IUPAC name is 3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22904936 |
| Molecular Formula | C28H34F3N5O6 |
| Molecular Weight | 593.60 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | 3-[7-[5-(diaminomethylideneamino)pentyl]-1-methyl-2,5-dioxo-3-phenyl-3H-1,4-benzodiazepin-4-yl]butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC(CC(=O)O)N1C(=O)c2cc(CCCCCN=C(N)N)ccc2N(C)C(=O)C1c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H33N5O4.C2HF3O2/c1-17(15-22(32)33)31-23(19-10-6-3-7-11-19)25(35)30(2)21-13-12-18(16-20(21)24(31)34)9-5-4-8-14-29-26(27)28;3-2(4,5)1(6)7/h3,6-7,10-13,16-17,23H,4-5,8-9,14-15H2,1-2H3,(H,32,33)(H4,27,28,29);(H,6,7) |
| InChIKey | CFYDIJGRGGNGKH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|