C23H32N2O3 — CID 22909771
N-[3-(3,4-dimethylphenyl)propyl]-2-(4-formamido-3-methoxyphenyl)acetamide;ethane (PubChem CID 22909771) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[3-(3,4-dimethylphenyl)propyl]-2-(4-formamido-3-methoxyphenyl)acetamide;ethane.
| Compound Name | N-[3-(3,4-dimethylphenyl)propyl]-2-(4-formamido-3-methoxyphenyl)acetamide;ethane |
|---|---|
| PubChem CID | 22909771 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | N-[3-(3,4-dimethylphenyl)propyl]-2-(4-formamido-3-methoxyphenyl)acetamide;ethane |
| SMILES | CC.COc1cc(CC(=O)NCCCc2ccc(C)c(C)c2)ccc1NC=O |
| InChI | InChI=1S/C21H26N2O3.C2H6/c1-15-6-7-17(11-16(15)2)5-4-10-22-21(25)13-18-8-9-19(23-14-24)20(12-18)26-3;1-2/h6-9,11-12,14H,4-5,10,13H2,1-3H3,(H,22,25)(H,23,24);1-2H3 |
| InChIKey | MEEXEVBQLICKSB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|