C25H34N2O5 — CID 69330570
ethyl 3-amino-3-[4-[2-[3-(3,4-dimethylphenyl)propylamino]-2-oxoethyl]-2-methoxyphenoxy]propanoate (PubChem CID 69330570) has the molecular formula C25H34N2O5 and a molecular weight of 442.56 g/mol. Its IUPAC name is ethyl 3-amino-3-[4-[2-[3-(3,4-dimethylphenyl)propylamino]-2-oxoethyl]-2-methoxyphenoxy]propanoate.
| Compound Name | ethyl 3-amino-3-[4-[2-[3-(3,4-dimethylphenyl)propylamino]-2-oxoethyl]-2-methoxyphenoxy]propanoate |
|---|---|
| PubChem CID | 69330570 |
| Molecular Formula | C25H34N2O5 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | ethyl 3-amino-3-[4-[2-[3-(3,4-dimethylphenyl)propylamino]-2-oxoethyl]-2-methoxyphenoxy]propanoate |
| SMILES | CCOC(=O)CC(N)Oc1ccc(CC(=O)NCCCc2ccc(C)c(C)c2)cc1OC |
| InChI | InChI=1S/C25H34N2O5/c1-5-31-25(29)16-23(26)32-21-11-10-20(14-22(21)30-4)15-24(28)27-12-6-7-19-9-8-17(2)18(3)13-19/h8-11,13-14,23H,5-7,12,15-16,26H2,1-4H3,(H,27,28) |
| InChIKey | PJEHNNLCJHJTOY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|