C13H10F2OS — CID 22911985
1-(2,4-difluorophenyl)-2-(4-methylthiophen-2-yl)ethanone (PubChem CID 22911985) has the molecular formula C13H10F2OS and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2-(4-methylthiophen-2-yl)ethanone.
| Compound Name | 1-(2,4-difluorophenyl)-2-(4-methylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 22911985 |
| Molecular Formula | C13H10F2OS |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2-(4-methylthiophen-2-yl)ethanone |
| SMILES | Cc1csc(CC(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C13H10F2OS/c1-8-4-10(17-7-8)6-13(16)11-3-2-9(14)5-12(11)15/h2-5,7H,6H2,1H3 |
| InChIKey | MYYXVXYQVBQGOC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |