C28H39F3N2O3 — CID 22913321
[1,1,1-trifluoro-3-[6-(4-octylphenyl)pyridazin-3-yl]oxypropan-2-yl] heptanoate (PubChem CID 22913321) has the molecular formula C28H39F3N2O3 and a molecular weight of 508.63 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-[6-(4-octylphenyl)pyridazin-3-yl]oxypropan-2-yl] heptanoate.
| Compound Name | [1,1,1-trifluoro-3-[6-(4-octylphenyl)pyridazin-3-yl]oxypropan-2-yl] heptanoate |
|---|---|
| PubChem CID | 22913321 |
| Molecular Formula | C28H39F3N2O3 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | [1,1,1-trifluoro-3-[6-(4-octylphenyl)pyridazin-3-yl]oxypropan-2-yl] heptanoate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(OCC(OC(=O)CCCCCC)C(F)(F)F)nn2)cc1 |
| InChI | InChI=1S/C28H39F3N2O3/c1-3-5-7-9-10-11-13-22-15-17-23(18-16-22)24-19-20-26(33-32-24)35-21-25(28(29,30)31)36-27(34)14-12-8-6-4-2/h15-20,25H,3-14,21H2,1-2H3 |
| InChIKey | JKHNHHFYXDRIFJ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|