C32H36F3NO4 — CID 22913433
(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-octylphenyl)-3-pyridinyl]benzoate (PubChem CID 22913433) has the molecular formula C32H36F3NO4 and a molecular weight of 555.64 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-octylphenyl)-3-pyridinyl]benzoate.
| Compound Name | (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-octylphenyl)-3-pyridinyl]benzoate |
|---|---|
| PubChem CID | 22913433 |
| Molecular Formula | C32H36F3NO4 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-octylphenyl)-3-pyridinyl]benzoate |
| SMILES | CCCCCCCCc1ccc(-c2ccc(-c3ccc(C(=O)OC(C(=O)OCCC)C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C32H36F3NO4/c1-3-5-6-7-8-9-10-23-11-13-25(14-12-23)28-20-19-27(22-36-28)24-15-17-26(18-16-24)30(37)40-29(32(33,34)35)31(38)39-21-4-2/h11-20,22,29H,3-10,21H2,1-2H3 |
| InChIKey | VUAATDHBNNBZDY-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|