C37H64Si6 — CID 22918074
[diethyl(trimethylsilyl)silyl]-[[diethyl(triphenylsilyl)silyl]-diethylsilyl]-diethylsilane (PubChem CID 22918074) has the molecular formula C37H64Si6 and a molecular weight of 677.44 g/mol. Its IUPAC name is [diethyl(trimethylsilyl)silyl]-[[diethyl(triphenylsilyl)silyl]-diethylsilyl]-diethylsilane.
| Compound Name | [diethyl(trimethylsilyl)silyl]-[[diethyl(triphenylsilyl)silyl]-diethylsilyl]-diethylsilane |
|---|---|
| PubChem CID | 22918074 |
| Molecular Formula | C37H64Si6 |
| Molecular Weight | 677.44 g/mol |
| Exact Mass | 676.36 |
| IUPAC Name | [diethyl(trimethylsilyl)silyl]-[[diethyl(triphenylsilyl)silyl]-diethylsilyl]-diethylsilane |
| SMILES | CC[Si](CC)([Si](C)(C)C)[Si](CC)(CC)[Si](CC)(CC)[Si](CC)(CC)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H64Si6/c1-12-39(13-2,38(9,10)11)40(14-3,15-4)41(16-5,17-6)42(18-7,19-8)43(35-29-23-20-24-30-35,36-31-25-21-26-32-36)37-33-27-22-28-34-37/h20-34H,12-19H2,1-11H3 |
| InChIKey | WWWAQNCFGGYUQL-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.44 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|