C15H15ClI4N2O4 — CID 22921398
3-[[6-[(2-chloroacetyl)amino]-2-iodohexanoyl]amino]-2,4,6-triiodobenzoic acid (PubChem CID 22921398) has the molecular formula C15H15ClI4N2O4 and a molecular weight of 830.36 g/mol. Its IUPAC name is 3-[[6-[(2-chloroacetyl)amino]-2-iodohexanoyl]amino]-2,4,6-triiodobenzoic acid.
| Compound Name | 3-[[6-[(2-chloroacetyl)amino]-2-iodohexanoyl]amino]-2,4,6-triiodobenzoic acid |
|---|---|
| PubChem CID | 22921398 |
| Molecular Formula | C15H15ClI4N2O4 |
| Molecular Weight | 830.36 g/mol |
| Exact Mass | 829.69 |
| IUPAC Name | 3-[[6-[(2-chloroacetyl)amino]-2-iodohexanoyl]amino]-2,4,6-triiodobenzoic acid |
| SMILES | O=C(CCl)NCCCCC(I)C(=O)Nc1c(I)cc(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C15H15ClI4N2O4/c16-6-10(23)21-4-2-1-3-7(17)14(24)22-13-9(19)5-8(18)11(12(13)20)15(25)26/h5,7H,1-4,6H2,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | RVMCURHCWNUGIE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|