About 9-cyclohexyl-3,7-dihydropurine-2,8-dione
9-cyclohexyl-3,7-dihydropurine-2,8-dione (PubChem CID 22923569) has the molecular formula C11H14N4O2
and a molecular weight of 234.26 g/mol. Its IUPAC name is 9-cyclohexyl-3,7-dihydropurine-2,8-dione.
Molecular Properties
| Compound Name | 9-cyclohexyl-3,7-dihydropurine-2,8-dione |
| PubChem CID | 22923569 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 9-cyclohexyl-3,7-dihydropurine-2,8-dione |
| SMILES | O=c1ncc2[nH]c(=O)n(C3CCCCC3)c2[nH]1 |
| InChI | InChI=1S/C11H14N4O2/c16-10-12-6-8-9(14-10)15(11(17)13-8)7-4-2-1-3-5-7/h6-7H,1-5H2,(H,13,17)(H,12,14,16) |
| InChIKey | FNKFZBMXYBCKGO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-cyclohexyl-3,7-dihydropurine-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-cyclohexyl-3,7-dihydropurine-2,8-dione?
The IUPAC name of 9-cyclohexyl-3,7-dihydropurine-2,8-dione (CID 22923569) is 9-cyclohexyl-3,7-dihydropurine-2,8-dione.
What is the SMILES notation for 9-cyclohexyl-3,7-dihydropurine-2,8-dione?
The canonical SMILES for 9-cyclohexyl-3,7-dihydropurine-2,8-dione is O=c1ncc2[nH]c(=O)n(C3CCCCC3)c2[nH]1.
What is the InChIKey of 9-cyclohexyl-3,7-dihydropurine-2,8-dione?
The InChIKey is FNKFZBMXYBCKGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2/c16-10-12-6-8-9(14-10)15(11(17)13-8)7-4-2-1-3-5-7/h6-7H,1-5H2,(H,13,17)(H,12,14,16).
What are the key properties of 9-cyclohexyl-3,7-dihydropurine-2,8-dione?
9-cyclohexyl-3,7-dihydropurine-2,8-dione has a molecular weight of 234.26 g/mol, XLogP of 0.92, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-cyclohexyl-3,7-dihydropurine-2,8-dione is sourced from PubChem (CID 22923569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).