C23H27FNSi — CID 22924554
CID 22924554 (PubChem CID 22924554) has the molecular formula C23H27FNSi and a molecular weight of 364.56 g/mol.
| Compound Name | CID 22924554 |
|---|---|
| PubChem CID | 22924554 |
| Molecular Formula | C23H27FNSi |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | — |
| SMILES | CCCCCC1CC[Si](c2ccc(-c3ccc(C#N)cc3F)cc2)CC1 |
| InChI | InChI=1S/C23H27FNSi/c1-2-3-4-5-18-12-14-26(15-13-18)21-9-7-20(8-10-21)22-11-6-19(17-25)16-23(22)24/h6-11,16,18H,2-5,12-15H2,1H3 |
| InChIKey | HATYQFYLCKUVQF-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|