C46H80N4Pd — CID 22924729
bis[1,3-bis(5-methyl-2-propan-2-ylcyclohexyl)imidazol-2-ylidene]palladium (PubChem CID 22924729) has the molecular formula C46H80N4Pd and a molecular weight of 795.59 g/mol. Its IUPAC name is bis[1,3-bis(5-methyl-2-propan-2-ylcyclohexyl)imidazol-2-ylidene]palladium.
| Compound Name | bis[1,3-bis(5-methyl-2-propan-2-ylcyclohexyl)imidazol-2-ylidene]palladium |
|---|---|
| PubChem CID | 22924729 |
| Molecular Formula | C46H80N4Pd |
| Molecular Weight | 795.59 g/mol |
| Exact Mass | 794.54 |
| IUPAC Name | bis[1,3-bis(5-methyl-2-propan-2-ylcyclohexyl)imidazol-2-ylidene]palladium |
| SMILES | CC1CCC(C(C)C)C(n2ccn(C3CC(C)CCC3C(C)C)c2=[Pd]=c2n(C3CC(C)CCC3C(C)C)ccn2C2CC(C)CCC2C(C)C)C1 |
| InChI | InChI=1S/2C23H40N2.Pd/c2*1-16(2)20-9-7-18(5)13-22(20)24-11-12-25(15-24)23-14-19(6)8-10-21(23)17(3)4;/h2*11-12,16-23H,7-10,13-14H2,1-6H3; |
| InChIKey | LLGQYHSPCKWZJL-UHFFFAOYSA-N |
| XLogP | 13.27 |
| TPSA | 19.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.59 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |