C20H21N3O5 — CID 2292557
5-[(2,4-dimethoxyphenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 2292557) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 5-[(2,4-dimethoxyphenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2,4-dimethoxyphenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2292557 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 5-[(2,4-dimethoxyphenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(CC2(CCc3ccncc3)C(=O)NC(=O)NC2=O)c(OC)c1 |
| InChI | InChI=1S/C20H21N3O5/c1-27-15-4-3-14(16(11-15)28-2)12-20(8-5-13-6-9-21-10-7-13)17(24)22-19(26)23-18(20)25/h3-4,6-7,9-11H,5,8,12H2,1-2H3,(H2,22,23,24,25,26) |
| InChIKey | BBBNIFZEEYUDND-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|