C25H23N3O4 — CID 1398560
5-[(4-phenylmethoxyphenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 1398560) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 5-[(4-phenylmethoxyphenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-phenylmethoxyphenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1398560 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 5-[(4-phenylmethoxyphenyl)methyl]-5-(2-pyridin-4-ylethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(CCc2ccncc2)(Cc2ccc(OCc3ccccc3)cc2)C(=O)N1 |
| InChI | InChI=1S/C25H23N3O4/c29-22-25(23(30)28-24(31)27-22,13-10-18-11-14-26-15-12-18)16-19-6-8-21(9-7-19)32-17-20-4-2-1-3-5-20/h1-9,11-12,14-15H,10,13,16-17H2,(H2,27,28,29,30,31) |
| InChIKey | MUONSNLIQQJNDJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|