C23H26FN3O3 — CID 22929865
2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)-1-(1,3,3-trimethyl-2H-indol-5-yl)ethanone (PubChem CID 22929865) has the molecular formula C23H26FN3O3 and a molecular weight of 411.48 g/mol. Its IUPAC name is 2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)-1-(1,3,3-trimethyl-2H-indol-5-yl)ethanone.
| Compound Name | 2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)-1-(1,3,3-trimethyl-2H-indol-5-yl)ethanone |
|---|---|
| PubChem CID | 22929865 |
| Molecular Formula | C23H26FN3O3 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)-1-(1,3,3-trimethyl-2H-indol-5-yl)ethanone |
| SMILES | [H]/N=C1/c2c(cc(OC)c(OC)c2F)CN1CC(=O)c1ccc2c(c1)C(C)(C)CN2C |
| InChI | InChI=1S/C23H26FN3O3/c1-23(2)12-26(3)16-7-6-13(8-15(16)23)17(28)11-27-10-14-9-18(29-4)21(30-5)20(24)19(14)22(27)25/h6-9,25H,10-12H2,1-5H3/b25-22- |
| InChIKey | VYHDLIOWWCKPIX-LVWGJNHUSA-N |
| XLogP | 3.59 |
| TPSA | 65.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|