C31H33FN2O6 — CID 67139980
2-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]phenoxy]-3-phenylpropanoic acid (PubChem CID 67139980) has the molecular formula C31H33FN2O6 and a molecular weight of 548.61 g/mol. Its IUPAC name is 2-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]phenoxy]-3-phenylpropanoic acid.
| Compound Name | 2-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]phenoxy]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67139980 |
| Molecular Formula | C31H33FN2O6 |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | 2-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]phenoxy]-3-phenylpropanoic acid |
| SMILES | [H]/N=C1/c2c(cc(OC)c(OC)c2F)CN1CC(=O)c1ccc(OC(Cc2ccccc2)C(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H33FN2O6/c1-31(2,3)21-14-19(11-12-23(21)40-25(30(36)37)13-18-9-7-6-8-10-18)22(35)17-34-16-20-15-24(38-4)28(39-5)27(32)26(20)29(34)33/h6-12,14-15,25,33H,13,16-17H2,1-5H3,(H,36,37)/b33-29- |
| InChIKey | GBSMMLGXQYDCGD-IYOYZZHUSA-N |
| XLogP | 5.24 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|