C25H30FN3O6 — CID 87284420
2-[[3-tert-butyl-5-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-2-hydroxyphenyl]methylamino]acetic acid (PubChem CID 87284420) has the molecular formula C25H30FN3O6 and a molecular weight of 487.53 g/mol. Its IUPAC name is 2-[[3-tert-butyl-5-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-2-hydroxyphenyl]methylamino]acetic acid.
| Compound Name | 2-[[3-tert-butyl-5-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-2-hydroxyphenyl]methylamino]acetic acid |
|---|---|
| PubChem CID | 87284420 |
| Molecular Formula | C25H30FN3O6 |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 2-[[3-tert-butyl-5-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-2-hydroxyphenyl]methylamino]acetic acid |
| SMILES | [H]/N=C1/c2c(cc(OC)c(OC)c2F)CN1CC(=O)c1cc(CNCC(=O)O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H30FN3O6/c1-25(2,3)16-7-13(6-14(22(16)33)9-28-10-19(31)32)17(30)12-29-11-15-8-18(34-4)23(35-5)21(26)20(15)24(29)27/h6-8,27-28,33H,9-12H2,1-5H3,(H,31,32)/b27-24- |
| InChIKey | NARCMVNVMHDRFS-PNHLSOANSA-N |
| XLogP | 3.04 |
| TPSA | 132.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|