C28H37FN4O5 — CID 150128776
N-[2-(4-aminobutoxy)-3-tert-butyl-5-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]phenyl]acetamide (PubChem CID 150128776) has the molecular formula C28H37FN4O5 and a molecular weight of 528.63 g/mol. Its IUPAC name is N-[2-(4-aminobutoxy)-3-tert-butyl-5-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]phenyl]acetamide.
| Compound Name | N-[2-(4-aminobutoxy)-3-tert-butyl-5-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]phenyl]acetamide |
|---|---|
| PubChem CID | 150128776 |
| Molecular Formula | C28H37FN4O5 |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | N-[2-(4-aminobutoxy)-3-tert-butyl-5-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]phenyl]acetamide |
| SMILES | [H]/N=C1/c2c(cc(OC)c(OC)c2F)CN1CC(=O)c1cc(NC(C)=O)c(OCCCCN)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H37FN4O5/c1-16(34)32-20-12-17(11-19(28(2,3)4)25(20)38-10-8-7-9-30)21(35)15-33-14-18-13-22(36-5)26(37-6)24(29)23(18)27(33)31/h11-13,31H,7-10,14-15,30H2,1-6H3,(H,32,34)/b31-27- |
| InChIKey | QIUVGJUQOZOBRW-QVTSOHHYSA-N |
| XLogP | 4.24 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|