C33H45BrFN3O6 — CID 69460771
ethyl 5-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-6-pyrrolidin-1-ylphenoxy]pentanoate;hydrobromide (PubChem CID 69460771) has the molecular formula C33H45BrFN3O6 and a molecular weight of 678.64 g/mol. Its IUPAC name is ethyl 5-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-6-pyrrolidin-1-ylphenoxy]pentanoate;hydrobromide.
| Compound Name | ethyl 5-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-6-pyrrolidin-1-ylphenoxy]pentanoate;hydrobromide |
|---|---|
| PubChem CID | 69460771 |
| Molecular Formula | C33H45BrFN3O6 |
| Molecular Weight | 678.64 g/mol |
| Exact Mass | 677.25 |
| IUPAC Name | ethyl 5-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-6-pyrrolidin-1-ylphenoxy]pentanoate;hydrobromide |
| SMILES | Br.[H]/N=C1/c2c(cc(OC)c(OC)c2F)CN1CC(=O)c1cc(N2CCCC2)c(OCCCCC(=O)OCC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H44FN3O6.BrH/c1-7-42-27(39)12-8-11-15-43-30-23(33(2,3)4)16-21(17-24(30)36-13-9-10-14-36)25(38)20-37-19-22-18-26(40-5)31(41-6)29(34)28(22)32(37)35;/h16-18,35H,7-15,19-20H2,1-6H3;1H/b35-32-; |
| InChIKey | QBCBYTXIAYUGHP-KCOKEDLUSA-N |
| XLogP | 6.45 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|