C33H44FN3O7 — CID 67137003
ethyl 5-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-6-morpholin-4-ylphenoxy]pentanoate (PubChem CID 67137003) has the molecular formula C33H44FN3O7 and a molecular weight of 613.73 g/mol. Its IUPAC name is ethyl 5-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-6-morpholin-4-ylphenoxy]pentanoate.
| Compound Name | ethyl 5-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-6-morpholin-4-ylphenoxy]pentanoate |
|---|---|
| PubChem CID | 67137003 |
| Molecular Formula | C33H44FN3O7 |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | ethyl 5-[2-tert-butyl-4-[2-(4-fluoro-3-imino-5,6-dimethoxy-1H-isoindol-2-yl)acetyl]-6-morpholin-4-ylphenoxy]pentanoate |
| SMILES | [H]/N=C1/c2c(cc(OC)c(OC)c2F)CN1CC(=O)c1cc(N2CCOCC2)c(OCCCCC(=O)OCC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H44FN3O7/c1-7-43-27(39)10-8-9-13-44-30-23(33(2,3)4)16-21(17-24(30)36-11-14-42-15-12-36)25(38)20-37-19-22-18-26(40-5)31(41-6)29(34)28(22)32(37)35/h16-18,35H,7-15,19-20H2,1-6H3/b35-32- |
| InChIKey | QHHZABGEEDSUQN-JCUPVDEDSA-N |
| XLogP | 5.11 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|