C24H31BrN4O4 — CID 87841959
2-[[3-tert-butyl-5-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-hydroxyphenyl]methylamino]acetic acid;hydrobromide (PubChem CID 87841959) has the molecular formula C24H31BrN4O4 and a molecular weight of 519.44 g/mol. Its IUPAC name is 2-[[3-tert-butyl-5-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-hydroxyphenyl]methylamino]acetic acid;hydrobromide.
| Compound Name | 2-[[3-tert-butyl-5-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-hydroxyphenyl]methylamino]acetic acid;hydrobromide |
|---|---|
| PubChem CID | 87841959 |
| Molecular Formula | C24H31BrN4O4 |
| Molecular Weight | 519.44 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 2-[[3-tert-butyl-5-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-2-hydroxyphenyl]methylamino]acetic acid;hydrobromide |
| SMILES | Br.[H]/N=C1/c2nc(CC)ccc2CN1CC(=O)c1cc(CNCC(=O)O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H30N4O4.BrH/c1-5-17-7-6-14-12-28(23(25)21(14)27-17)13-19(29)15-8-16(10-26-11-20(30)31)22(32)18(9-15)24(2,3)4;/h6-9,25-26,32H,5,10-13H2,1-4H3,(H,30,31);1H/b25-23-; |
| InChIKey | QUPZWYCPXLYPGS-ADYMNVQMSA-N |
| XLogP | 3.42 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|