C24H29N3O3 — CID 67138944
3-[2-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenyl]propanoic acid (PubChem CID 67138944) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-[2-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenyl]propanoic acid.
| Compound Name | 3-[2-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67138944 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 3-[2-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenyl]propanoic acid |
| SMILES | [H]/N=C1/c2nc(CC)ccc2CN1CC(=O)c1ccc(CCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H29N3O3/c1-5-18-10-8-17-13-27(23(25)22(17)26-18)14-20(28)16-7-6-15(9-11-21(29)30)19(12-16)24(2,3)4/h6-8,10,12,25H,5,9,11,13-14H2,1-4H3,(H,29,30)/b25-23- |
| InChIKey | RNPNEXOXMVAJAG-BZZOAKBMSA-N |
| XLogP | 3.98 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|