C24H28N4O3 — CID 67139134
8-tert-butyl-6-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-4-methyl-1,4-benzoxazin-3-one (PubChem CID 67139134) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 8-tert-butyl-6-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-4-methyl-1,4-benzoxazin-3-one.
| Compound Name | 8-tert-butyl-6-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-4-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 67139134 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 8-tert-butyl-6-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-4-methyl-1,4-benzoxazin-3-one |
| SMILES | [H]/N=C1\c2nc(CC)ccc2CN1CC(=O)c1cc2c(c(C(C)(C)C)c1)OCC(=O)N2C |
| InChI | InChI=1S/C24H28N4O3/c1-6-16-8-7-14-11-28(23(25)21(14)26-16)12-19(29)15-9-17(24(2,3)4)22-18(10-15)27(5)20(30)13-31-22/h7-10,25H,6,11-13H2,1-5H3/b25-23+ |
| InChIKey | WXLLPCBTQNKGEJ-WJTDDFOZSA-N |
| XLogP | 3.32 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|