C26H33N3O5 — CID 67139056
4-[2-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenoxy]butanoic acid (PubChem CID 67139056) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-[2-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenoxy]butanoic acid.
| Compound Name | 4-[2-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenoxy]butanoic acid |
|---|---|
| PubChem CID | 67139056 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 4-[2-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenoxy]butanoic acid |
| SMILES | [H]/N=C1/c2nc(CC)ccc2CN1CC(=O)c1cc(OC)c(OCCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H33N3O5/c1-6-18-10-9-16-14-29(25(27)23(16)28-18)15-20(30)17-12-19(26(2,3)4)24(21(13-17)33-5)34-11-7-8-22(31)32/h9-10,12-13,27H,6-8,11,14-15H2,1-5H3,(H,31,32)/b27-25- |
| InChIKey | GJDFDEPZGYGRON-RFBIWTDZSA-N |
| XLogP | 4.22 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|