C29H38N4O6 — CID 67138414
2-[2-(4-acetamidobutoxy)-6-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]acetic acid (PubChem CID 67138414) has the molecular formula C29H38N4O6 and a molecular weight of 538.65 g/mol. Its IUPAC name is 2-[2-(4-acetamidobutoxy)-6-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]acetic acid.
| Compound Name | 2-[2-(4-acetamidobutoxy)-6-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67138414 |
| Molecular Formula | C29H38N4O6 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 2-[2-(4-acetamidobutoxy)-6-tert-butyl-4-[2-(2-ethyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]acetic acid |
| SMILES | [H]/N=C1/c2nc(CC)ccc2CN1CC(=O)c1cc(OCCCCNC(C)=O)c(OCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H38N4O6/c1-6-21-10-9-19-15-33(28(30)26(19)32-21)16-23(35)20-13-22(29(3,4)5)27(39-17-25(36)37)24(14-20)38-12-8-7-11-31-18(2)34/h9-10,13-14,30H,6-8,11-12,15-17H2,1-5H3,(H,31,34)(H,36,37)/b30-28- |
| InChIKey | YGJKAKUKGSASBC-HYOGKJQXSA-N |
| XLogP | 3.72 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|