C28H33BrN4O5 — CID 67139488
2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]acetic acid;hydrobromide (PubChem CID 67139488) has the molecular formula C28H33BrN4O5 and a molecular weight of 585.50 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]acetic acid;hydrobromide.
| Compound Name | 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]acetic acid;hydrobromide |
|---|---|
| PubChem CID | 67139488 |
| Molecular Formula | C28H33BrN4O5 |
| Molecular Weight | 585.50 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]acetic acid;hydrobromide |
| SMILES | Br.[H]/N=C1/c2nc(C3CC3)ccc2CN1CC(=O)c1cc(OCCCC#N)c(OCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H32N4O5.BrH/c1-28(2,3)20-12-19(13-23(36-11-5-4-10-29)26(20)37-16-24(34)35)22(33)15-32-14-18-8-9-21(17-6-7-17)31-25(18)27(32)30;/h8-9,12-13,17,30H,4-7,11,14-16H2,1-3H3,(H,34,35);1H/b30-27-; |
| InChIKey | XHALPMHWHKMEJE-NHUYCKTKSA-N |
| XLogP | 5.00 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|