C30H36N4O5 — CID 67138437
2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[4-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)-3-oxobutyl]phenoxy]acetic acid (PubChem CID 67138437) has the molecular formula C30H36N4O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[4-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)-3-oxobutyl]phenoxy]acetic acid.
| Compound Name | 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[4-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)-3-oxobutyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67138437 |
| Molecular Formula | C30H36N4O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[4-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)-3-oxobutyl]phenoxy]acetic acid |
| SMILES | [H]/N=C1/c2nc(C3CC3)ccc2CN1CC(=O)CCc1cc(OCCCC#N)c(OCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H36N4O5/c1-30(2,3)23-14-19(15-25(38-13-5-4-12-31)28(23)39-18-26(36)37)6-10-22(35)17-34-16-21-9-11-24(20-7-8-20)33-27(21)29(34)32/h9,11,14-15,20,32H,4-8,10,13,16-18H2,1-3H3,(H,36,37)/b32-29- |
| InChIKey | LWDJKHPIRVBPGQ-OVXWJCGASA-N |
| XLogP | 4.75 |
| TPSA | 136.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|