C31H39N5O7 — CID 67137339
2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[4-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]-3-oxobutyl]phenoxy]acetic acid (PubChem CID 67137339) has the molecular formula C31H39N5O7 and a molecular weight of 593.68 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[4-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]-3-oxobutyl]phenoxy]acetic acid.
| Compound Name | 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[4-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]-3-oxobutyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 67137339 |
| Molecular Formula | C31H39N5O7 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[4-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]-3-oxobutyl]phenoxy]acetic acid |
| SMILES | [H]/N=C1/c2nc(C(=O)NC)c(OCC)cc2CN1CC(=O)CCc1cc(OCCCC#N)c(OCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H39N5O7/c1-6-41-23-15-20-16-36(29(33)26(20)35-27(23)30(40)34-5)17-21(37)10-9-19-13-22(31(2,3)4)28(43-18-25(38)39)24(14-19)42-12-8-7-11-32/h13-15,33H,6-10,12,16-18H2,1-5H3,(H,34,40)(H,38,39)/b33-29- |
| InChIKey | MBOORIRULRZFKS-IYOYZZHUSA-N |
| XLogP | 3.63 |
| TPSA | 174.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|