C33H45N5O6 — CID 67137572
6-[2-tert-butyl-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]-6-pyrrolidin-1-ylphenoxy]hexanoic acid (PubChem CID 67137572) has the molecular formula C33H45N5O6 and a molecular weight of 607.75 g/mol. Its IUPAC name is 6-[2-tert-butyl-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]-6-pyrrolidin-1-ylphenoxy]hexanoic acid.
| Compound Name | 6-[2-tert-butyl-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]-6-pyrrolidin-1-ylphenoxy]hexanoic acid |
|---|---|
| PubChem CID | 67137572 |
| Molecular Formula | C33H45N5O6 |
| Molecular Weight | 607.75 g/mol |
| Exact Mass | 607.34 |
| IUPAC Name | 6-[2-tert-butyl-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]-6-pyrrolidin-1-ylphenoxy]hexanoic acid |
| SMILES | [H]/N=C1/c2nc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(N2CCCC2)c(OCCCCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H45N5O6/c1-6-43-26-18-22-19-38(31(34)28(22)36-29(26)32(42)35-5)20-25(39)21-16-23(33(2,3)4)30(24(17-21)37-13-9-10-14-37)44-15-11-7-8-12-27(40)41/h16-18,34H,6-15,19-20H2,1-5H3,(H,35,42)(H,40,41)/b34-31- |
| InChIKey | VPUJYWHLEHXEGC-NMSHJFGGSA-N |
| XLogP | 4.79 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.75 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|