C31H43N5O6 — CID 67137580
4-[2-tert-butyl-6-(diethylamino)-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenoxy]butanoic acid (PubChem CID 67137580) has the molecular formula C31H43N5O6 and a molecular weight of 581.71 g/mol. Its IUPAC name is 4-[2-tert-butyl-6-(diethylamino)-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenoxy]butanoic acid.
| Compound Name | 4-[2-tert-butyl-6-(diethylamino)-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 67137580 |
| Molecular Formula | C31H43N5O6 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | 4-[2-tert-butyl-6-(diethylamino)-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenoxy]butanoic acid |
| SMILES | [H]/N=C1/c2nc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(N(CC)CC)c(OCCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C31H43N5O6/c1-8-35(9-2)22-15-19(14-21(31(4,5)6)28(22)42-13-11-12-25(38)39)23(37)18-36-17-20-16-24(41-10-3)27(30(40)33-7)34-26(20)29(36)32/h14-16,32H,8-13,17-18H2,1-7H3,(H,33,40)(H,38,39)/b32-29- |
| InChIKey | LLSGXUJSXKKLIH-OVXWJCGASA-N |
| XLogP | 4.25 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|