C27H33N5O6 — CID 67139869
4-[3-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]-5-pyrrolidin-1-ylphenoxy]butanoic acid (PubChem CID 67139869) has the molecular formula C27H33N5O6 and a molecular weight of 523.59 g/mol. Its IUPAC name is 4-[3-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]-5-pyrrolidin-1-ylphenoxy]butanoic acid.
| Compound Name | 4-[3-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]-5-pyrrolidin-1-ylphenoxy]butanoic acid |
|---|---|
| PubChem CID | 67139869 |
| Molecular Formula | C27H33N5O6 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 4-[3-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]-5-pyrrolidin-1-ylphenoxy]butanoic acid |
| SMILES | [H]/N=C1/c2nc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(OCCCC(=O)O)cc(N2CCCC2)c1 |
| InChI | InChI=1S/C27H33N5O6/c1-3-37-22-13-18-15-32(26(28)24(18)30-25(22)27(36)29-2)16-21(33)17-11-19(31-8-4-5-9-31)14-20(12-17)38-10-6-7-23(34)35/h11-14,28H,3-10,15-16H2,1-2H3,(H,29,36)(H,34,35)/b28-26- |
| InChIKey | BOLTWPBXDNGEPQ-SGEDCAFJSA-N |
| XLogP | 2.71 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|