C24H31BrN4O6S — CID 23107026
[2-butyl-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenyl] methanesulfonate;hydrobromide (PubChem CID 23107026) has the molecular formula C24H31BrN4O6S and a molecular weight of 583.51 g/mol. Its IUPAC name is [2-butyl-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenyl] methanesulfonate;hydrobromide.
| Compound Name | [2-butyl-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenyl] methanesulfonate;hydrobromide |
|---|---|
| PubChem CID | 23107026 |
| Molecular Formula | C24H31BrN4O6S |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | [2-butyl-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenyl] methanesulfonate;hydrobromide |
| SMILES | Br.[H]/N=C1/c2nc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1ccc(OS(C)(=O)=O)c(CCCC)c1 |
| InChI | InChI=1S/C24H30N4O6S.BrH/c1-5-7-8-16-11-15(9-10-19(16)34-35(4,31)32)18(29)14-28-13-17-12-20(33-6-2)22(24(30)26-3)27-21(17)23(28)25;/h9-12,25H,5-8,13-14H2,1-4H3,(H,26,30);1H/b25-23-; |
| InChIKey | HQEUDLJVHQQKOF-ADYMNVQMSA-N |
| XLogP | 3.12 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|