C32H41N5O7 — CID 67138307
2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenoxy]pentanoic acid (PubChem CID 67138307) has the molecular formula C32H41N5O7 and a molecular weight of 607.71 g/mol. Its IUPAC name is 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenoxy]pentanoic acid.
| Compound Name | 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 67138307 |
| Molecular Formula | C32H41N5O7 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | 2-[2-tert-butyl-6-(3-cyanopropoxy)-4-[2-[3-ethoxy-7-imino-2-(methylcarbamoyl)-5H-pyrrolo[3,4-b]pyridin-6-yl]acetyl]phenoxy]pentanoic acid |
| SMILES | [H]/N=C1/c2nc(C(=O)NC)c(OCC)cc2CN1CC(=O)c1cc(OCCCC#N)c(OC(CCC)C(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H41N5O7/c1-7-11-23(31(40)41)44-28-21(32(3,4)5)14-19(15-25(28)43-13-10-9-12-33)22(38)18-37-17-20-16-24(42-8-2)27(30(39)35-6)36-26(20)29(37)34/h14-16,23,34H,7-11,13,17-18H2,1-6H3,(H,35,39)(H,40,41)/b34-29- |
| InChIKey | RCBNZUYTHAKPMW-BNIPGBBVSA-N |
| XLogP | 4.48 |
| TPSA | 174.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|