C27H34N4O4 — CID 67137911
4-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenoxy]butanamide (PubChem CID 67137911) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 4-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenoxy]butanamide.
| Compound Name | 4-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenoxy]butanamide |
|---|---|
| PubChem CID | 67137911 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 4-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenoxy]butanamide |
| SMILES | [H]/N=C1/c2nc(C3CC3)ccc2CN1CC(=O)c1cc(OC)c(OCCCC(N)=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C27H34N4O4/c1-27(2,3)19-12-18(13-22(34-4)25(19)35-11-5-6-23(28)33)21(32)15-31-14-17-9-10-20(16-7-8-16)30-24(17)26(31)29/h9-10,12-13,16,29H,5-8,11,14-15H2,1-4H3,(H2,28,33)/b29-26- |
| InChIKey | IUYNZFDGMXVXMJ-WCTVFOPTSA-N |
| XLogP | 3.93 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|