C33H42N4O5 — CID 67139183
ethyl 4-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-(4-oxopiperidin-1-yl)phenoxy]butanoate (PubChem CID 67139183) has the molecular formula C33H42N4O5 and a molecular weight of 574.72 g/mol. Its IUPAC name is ethyl 4-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-(4-oxopiperidin-1-yl)phenoxy]butanoate.
| Compound Name | ethyl 4-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-(4-oxopiperidin-1-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 67139183 |
| Molecular Formula | C33H42N4O5 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | ethyl 4-[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-(4-oxopiperidin-1-yl)phenoxy]butanoate |
| SMILES | [H]/N=C1/c2nc(C3CC3)ccc2CN1CC(=O)c1cc(N2CCC(=O)CC2)c(OCCCC(=O)OCC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H42N4O5/c1-5-41-29(40)7-6-16-42-31-25(33(2,3)4)17-23(18-27(31)36-14-12-24(38)13-15-36)28(39)20-37-19-22-10-11-26(21-8-9-21)35-30(22)32(37)34/h10-11,17-18,21,34H,5-9,12-16,19-20H2,1-4H3/b34-32- |
| InChIKey | KYWAGWZBNTVELI-YJKCNMNRSA-N |
| XLogP | 5.17 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|