C34H44BrN5O4 — CID 69458782
methyl 5-[2-tert-butyl-6-(4-cyanopiperidin-1-yl)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]pentanoate;hydrobromide (PubChem CID 69458782) has the molecular formula C34H44BrN5O4 and a molecular weight of 666.66 g/mol. Its IUPAC name is methyl 5-[2-tert-butyl-6-(4-cyanopiperidin-1-yl)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]pentanoate;hydrobromide.
| Compound Name | methyl 5-[2-tert-butyl-6-(4-cyanopiperidin-1-yl)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]pentanoate;hydrobromide |
|---|---|
| PubChem CID | 69458782 |
| Molecular Formula | C34H44BrN5O4 |
| Molecular Weight | 666.66 g/mol |
| Exact Mass | 665.26 |
| IUPAC Name | methyl 5-[2-tert-butyl-6-(4-cyanopiperidin-1-yl)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]pentanoate;hydrobromide |
| SMILES | Br.[H]/N=C1/c2nc(C3CC3)ccc2CN1CC(=O)c1cc(N2CCC(C#N)CC2)c(OCCCCC(=O)OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H43N5O4.BrH/c1-34(2,3)26-17-25(29(40)21-39-20-24-10-11-27(23-8-9-23)37-31(24)33(39)36)18-28(38-14-12-22(19-35)13-15-38)32(26)43-16-6-5-7-30(41)42-4;/h10-11,17-18,22-23,36H,5-9,12-16,20-21H2,1-4H3;1H/b36-33-; |
| InChIKey | MAXIIBIWXWISSO-YKEDXUKRSA-N |
| XLogP | 6.32 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.66 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|