C30H36N4O4 — CID 67138182
5-[2-tert-butyl-6-(2-cyanoethyl)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]pentanoic acid (PubChem CID 67138182) has the molecular formula C30H36N4O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is 5-[2-tert-butyl-6-(2-cyanoethyl)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]pentanoic acid.
| Compound Name | 5-[2-tert-butyl-6-(2-cyanoethyl)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]pentanoic acid |
|---|---|
| PubChem CID | 67138182 |
| Molecular Formula | C30H36N4O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 5-[2-tert-butyl-6-(2-cyanoethyl)-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]phenoxy]pentanoic acid |
| SMILES | [H]/N=C1/c2nc(C3CC3)ccc2CN1CC(=O)c1cc(CCC#N)c(OCCCCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H36N4O4/c1-30(2,3)23-16-22(15-20(7-6-13-31)28(23)38-14-5-4-8-26(36)37)25(35)18-34-17-21-11-12-24(19-9-10-19)33-27(21)29(34)32/h11-12,15-16,19,32H,4-10,14,17-18H2,1-3H3,(H,36,37)/b32-29- |
| InChIKey | LUTFZJPXTDDXHC-OVXWJCGASA-N |
| XLogP | 5.37 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|