C24H29N3O5S — CID 87284367
[2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenyl] methanesulfonate (PubChem CID 87284367) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is [2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenyl] methanesulfonate.
| Compound Name | [2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 87284367 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | [2-tert-butyl-4-[2-(2-cyclopropyl-7-imino-5H-pyrrolo[3,4-b]pyridin-6-yl)acetyl]-6-methoxyphenyl] methanesulfonate |
| SMILES | [H]/N=C1/c2nc(C3CC3)ccc2CN1CC(=O)c1cc(OC)c(OS(C)(=O)=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H29N3O5S/c1-24(2,3)17-10-16(11-20(31-4)22(17)32-33(5,29)30)19(28)13-27-12-15-8-9-18(14-6-7-14)26-21(15)23(27)25/h8-11,14,25H,6-7,12-13H2,1-5H3/b25-23- |
| InChIKey | XIJRMCDOHZDPKV-BZZOAKBMSA-N |
| XLogP | 3.63 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|